No products
View larger AOB24853803
CAS: 24853-80-3
Chemical Name: 5-methyl-3-(4-methylpiperazin-1-yl)pyridazino[3,4-b][1,4]benzoxazine hydrochloride
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $12.75 | Total: $63.75 |
| 1 | 10 | $10.80 | Total: $108.00 |
| 1 | 25 | $9.15 | Total: $228.75 |
| 1 | 50 | $7.80 | Total: $390.00 |
| 1 | 100 | $6.75 | Total: $675.00 |
| Molecular Formula | C16H19N5O 2HCl |
| Molecular Weight | 370.28 |
| CAS Numbers | 24853-80-3 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | Azaphen HCl; Azafen; Pipofezine; Pipofezine HCl |
| IUPAC/Chemical Name | 10-Methyl-3-(4-methyl-piperazin-1-yl)-10H-9-oxa-1,2,10-triaza-anthracene dihydrochloride |
| InChl Key | JVONTAXIALFQJM-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C16H19N5O.ClH/c1-19-7-9-21(10-8-19)15-11-13-16(18-17-15)22-14-6-4-3-5-12(14)20(13)2;/h3-6,11H,7-10H2,1-2H3;1H |
| SMILES Code | CN1CCN(C2=NN=C3OC4=CC=CC=C4N(C)C3=C2)CC1.[H]Cl |
| References | 1) NN Shinaev, AG Akzhigitov. Azaphen: a return to clinical practice. (Article in Russian). Zh Nevrol Psikhiatr Im S S Korsakova. 2005, 105(10), 55-6. |
A serotonin reuptake inhibitor with antidepressant action and sedative effects and antihistamine activity.