No products
View larger ATN6088
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $117.30 | Total: $586.50 |
| 1 | 10 | $99.36 | Total: $993.60 |
| 1 | 25 | $84.18 | Total: $2,104.50 |
| 1 | 50 | $71.76 | Total: $3,588.00 |
| 1 | 100 | $62.10 | Total: $6,210.00 |
| Molecular Formula | C34H37N3O6 |
| Molecular Weight | 583.67 |
| CAS Numbers | 131086-78-7 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | C(=CC(N(CCCNC(C=CC1=CC=C(O)C=C1)=O)CCCCNC(C=CC2=CC=C(O)C=C2)=O)=O)C3=CC=C(O)C=C3 |
| References | Isolation and purification of coumaroylspermidines from Carthamus tinctorius L. and their inhibition effects on [~3H]-5-HT reuptake. Journal of Shanxi Medical University, 2015. |