No products
View larger AT12597
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $515.95 | Total: $2,579.75 |
| 1 | 10 | $437.04 | Total: $4,370.40 |
| 1 | 25 | $370.27 | Total: $9,256.75 |
| 1 | 50 | $315.64 | Total: $15,782.00 |
| 1 | 100 | $273.15 | Total: $27,315.00 |
| Molecular Formula | C22H29FN4O2 |
| Molecular Weight | 400.49 |
| CAS Numbers | 191592-09-3 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | CN1C2=C(C(=O)N(CCCN3CCN(CC3)C4=CC=C(F)C=C4)CCC2O)C=C1 |
| References | Mizuno A, et al. Synthesis and serotonin 2 [5-HT2] receptor antagonist activity of 5-aminoalkyl-substituted pyrrolo[3,2-c]azepines and related compounds. Chem Pharm Bull [Tokyo]. 2000 May;48[5] 623-35. |