No products
View larger AT27827
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $181.05 | Total: $905.25 |
| 1 | 10 | $153.36 | Total: $1,533.60 |
| 1 | 25 | $129.93 | Total: $3,248.25 |
| 1 | 50 | $110.76 | Total: $5,538.00 |
| 1 | 100 | $95.85 | Total: $9,585.00 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 |
| CAS Numbers | 109214-55-3 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | C(C(O)=O)N1C=2C(CC[C@H](N[C@@H](CCCCN)C(O)=O)C1=O)=CC=CC2 |
| References | Tang JP, Rakhit A, Douglas FL, Melethil S. Effect of chronic hypertension on the blood-brain barrier permeability of libenzapril. Pharm Res. 1992 Feb;9[2] 236-43. PubMed PMID 1553348. |