View larger AT7895
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $40.80 | Total: $204.00 |
| 1 | 10 | $34.56 | Total: $345.60 |
| 1 | 25 | $29.28 | Total: $732.00 |
| 1 | 50 | $24.96 | Total: $1,248.00 |
| 1 | 100 | $21.60 | Total: $2,160.00 |
| Molecular Formula | C19H29N5O3.2(C2H4O2) |
| Molecular Weight | 495.58 |
| CAS Numbers | 823202-99-9 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | CC(O)=O.CC(O)=O.NCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)CCN)C(=O)NCc1ccccc1 |
| References | Balaev A N , Okhmanovich K A , Osipov V N . A shortened, protecting group free, synthesis of the anti-wrinkle venom analogue Syn-Ake? exploiting an optimized Hofmann-type rearrangement[J]. Tetrahedron Letters, 2014, 55[42] 5745-5747. |