No products
View larger AT10961
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $163.20 | Total: $816.00 |
| 1 | 10 | $138.24 | Total: $1,382.40 |
| 1 | 25 | $117.12 | Total: $2,928.00 |
| 1 | 50 | $99.84 | Total: $4,992.00 |
| 1 | 100 | $86.40 | Total: $8,640.00 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.41 |
| CAS Numbers | 84629-61-8 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | C(C(=O)N1CCN(C)CC1)=C2C=3C(C(=O)NC=4C2=CC=CC4)=CC=CC3 |
| References | Eric Elenko, et al. Methods and compositions for treatment of disorders ameliorated by muscarinic receptor activation. US 20170095465 A1. |