No products
View larger AT8552
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $30.60 | Total: $153.00 |
| 1 | 10 | $25.92 | Total: $259.20 |
| 1 | 25 | $21.96 | Total: $549.00 |
| 1 | 50 | $18.72 | Total: $936.00 |
| 1 | 100 | $16.20 | Total: $1,620.00 |
| Molecular Formula | C18H23F3N2O5 |
| Molecular Weight | 404.38 |
| CAS Numbers | 1336913-03-1 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | OC(=O)C(F)(F)F.COc1ccc(OC)c(c1)C(=O)N[C@@H]1CN2CCC1CC2 |
| References | Christopher JM, et, al. Chemical and genetic engineering of selective ion channel-ligand interactions. Science. 2011 Sep 2; 333[6047] 1292-6. |