No products
View larger AOB36216
CAS No: 618361-63-0
Chemical Name: 4-(2,3-Dihydro-1,4-benzodioxin-6-ylcarbonyl)-3-hydroxy-5-[4-(pentyloxy)phenyl]-1-(3-pyridinylmethyl)-1,5-dihydro-2H-pyrrol-2-one
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $58.65 | Total: $293.25 |
| 1 | 10 | $49.68 | Total: $496.80 |
| 1 | 25 | $42.09 | Total: $1,052.25 |
| 1 | 50 | $35.88 | Total: $1,794.00 |
| 1 | 100 | $31.05 | Total: $3,105.00 |
| Molecular Formula | C30H30N2O6 |
| Molecular Weight | 514.58 |
| CAS Numbers | 618361-63-0 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | ZINC-08383544; ZINC 08383544; ZINC08383544 |
| IUPAC/Chemical Name | 4-(2,3-Dihydro-1,4-benzodioxin-6-ylcarbonyl)-3-hydroxy-5-[4-(pentyloxy)phenyl]-1-(3-pyridinylmethyl)-1,5-dihydro-2H-pyrrol-2-one |
| InChl Key | UEEMPANMROSHCK-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C30H30N2O6/c1-2-3-4-14-36-23-10-7-21(8-11-23)27-26(28(33)22-9-12-24-25(17-22)38-16-15-37-24)29(34)30(35)32(27)19-20-6-5-13-31-18-20/h5-13,17-18,27,34H,2-4,14-16,19H2,1H3 |
| SMILES Code | O=C1N(CC2=CC=CN=C2)C(C3=CC=C(OCCCCC)C=C3)C(C(C4=CC=C(OCCO5)C5=C4)=O)=C1O |
| References | Li Y, Bao M, Yang C, Chen J, Zhou S, Sun R, Wu C, Li X, Bao J. Computer-aided identification of a novel pyruvate kinase M2 activator compound. Cell Prolif. 2018 Dec;51(6):e12509. |
Novel specific pyruvate kinase M2 activator, promoting the formation of PKM2 tetramer, effectively blocking PKM2 nuclear translocation, and inhibiting the growth of tumour