No products
View larger AOB36865
CAS No: 358721-70-7
Chemical Name: MC3154; 4-Pyridin-3-yl-4,5-dihydro-pyrrolo[1,2-a]quinoxaline
934 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $23.38 | Total: $116.88 |
| 1 | 10 | $19.80 | Total: $198.00 |
| 1 | 25 | $16.78 | Total: $419.38 |
| 1 | 50 | $14.30 | Total: $715.00 |
| 1 | 100 | $12.38 | Total: $1,237.50 |
| Molecular Formula | C16H13N3 |
| Molecular Weight | 247.30 |
| CAS Numbers | 358721-70-7 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | MC-3154; MC3154; MC 3154; UBCS-039; UBCS039; UBC S039 |
| IUPAC/Chemical Name | 4-Pyridin-3-yl-4,5-dihydro-pyrrolo[1,2-a]quinoxaline |
| InChl Key | BSOBGTYXYGHUTD-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C16H13N3/c1-2-7-14-13(6-1)18-16(12-5-3-9-17-11-12)15-8-4-10-19(14)15/h1-11,16,18H |
| SMILES Code | N12C(C(C3=CC=CN=C3)NC4=C2C=CC=C4)=CC=C1 |
| References | Iachettini S, Trisciuoglio D, Rotili D, Lucidi A, Salvati E, Zizza P, Di Leo L, Del Bufalo D, Ciriolo MR, Leonetti C, Steegborn C, Mai A, Rizzo A, Biroccio A. Pharmacological activation of SIRT6 triggers lethal autophagy in human cancer cells. Cell Death Dis. 2018 Sep 24;9(10):996. |
The first synthetic Sirt6 activator