No products
View larger AOB1563
CAS: 1221186-52-2
Chemical Name: 6-[(3-methoxyphenyl)methyl]-4-methyl-2-methylsulfinylthieno[3,4]pyrrolo[1,3-d]pyridazin-5-one; ML-202
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $67.15 | Total: $335.75 |
| 1 | 10 | $56.88 | Total: $568.80 |
| 1 | 25 | $48.19 | Total: $1,204.75 |
| 1 | 50 | $41.08 | Total: $2,054.00 |
| 1 | 100 | $35.55 | Total: $3,555.00 |
| Molecular Formula | C18H17N3O3S2 |
| Molecular Weight | 387.48 |
| CAS Numbers | 1221186-52-2 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | ML 202, ML202, ML-202 |
| IUPAC/Chemical Name | 4,6-Dihydro-6-[(3-methoxyphenyl)methyl]-4-methyl-2-(methylsulfinyl)-5H-thieno[2',3':4,5]pyrrolo[2,3-d]pyridazin-5-one |
| InChl Code | MORBXZMIXGYQDB-UHFFFAOYSA-N |
| SMILES Code | O=C1N(CC4=CC=CC(OC)=C4)N=CC2=C1N(C)C3=C2SC(S(C)=O)=C3 |
| References | 1) Boxer et al (2010) Identification of activators for the M2 isoform of human pyruvate kinase version 3. Probe Reports from the Molecular Libraries Program PMID: 21735594 2) Jiang et al (2010) Evaluation of thieno[3,2-b]pyrrole[3,2-d]pyridazinones as activators of the tumor cell specific M2 isoform of pyruvate kinase. Bioorg.Med.Chem.Lett. 20 3387 PMID: 20451379 |
Highly specific allosteric activator for the tumor-specific isoform of human pyruvate kinase M2 isoform (PKM2)