No products
View larger AOB8021
CAS No: 61337-67-5
Chemical Name: Remeron; Remergil; Zispin; Remergon; Rexer; 2-Methyl-1,2,3,4,10,14b-hexahydrobenzo[c]pyrazino[1,2-a]pyrido[3,2-f]azepine
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $12.75 | Total: $63.75 |
| 1 | 10 | $10.80 | Total: $108.00 |
| 1 | 25 | $9.15 | Total: $228.75 |
| 1 | 50 | $7.80 | Total: $390.00 |
| 1 | 100 | $6.75 | Total: $675.00 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.35 |
| CAS Numbers | 61337-67-5 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | Mirtazapine |
| IUPAC/Chemical Name | 2-Methyl-1,2,3,4,10,14b-hexahydrobenzo[c]pyrazino[1,2-a]pyrido[3,2-f]azepine |
| InChl Key | RONZAEMNMFQXRA-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C17H19N3/c1-19-9-10-20-16(12-19)15-7-3-2-5-13(15)11-14-6-4-8-18-17(14)20/h2-8,16H,9-12H2,1H3 |
| SMILES Code | CN(CC1)CC2N1C3=NC=CC=C3CC4=CC=CC=C24 |
| References | Cardon-Dunbar A, Robertson T, Roberts MS, Isbister GK. Pramipexole Overdose Associated with Visual Hallucinations, Agitation and Myoclonus. J Med Toxicol. 2017 May 25. |
Noradrenergic and specific serotonergic antidepressant (NaSSA)