No products
View larger AOB12079
CAS: 1337962-47-6
Chemical Name: PBF509; 5-Bromo-2,6-di(pyrazol-1-yl)pyrimidin-4-amine
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $22.95 | Total: $114.75 |
| 1 | 10 | $19.44 | Total: $194.40 |
| 1 | 25 | $16.47 | Total: $411.75 |
| 1 | 50 | $14.04 | Total: $702.00 |
| 1 | 100 | $12.15 | Total: $1,215.00 |
| Molecular Formula | C10H8BrN7 |
| Molecular Weight | 306.13 |
| CAS Numbers | 1337962-47-6 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | Taminadenant |
| IUPAC/Chemical Name | 5-bromo-2,6-di(1H-pyrazol-1-yl)pyrimidin-4-amine |
| InChl Key | ATFXVNUWQOXRRU-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C10H8BrN7/c11-7-8(12)15-10(18-6-2-4-14-18)16-9(7)17-5-1-3-13-17/h1-6H,(H2,12,15,16) |
| SMILES Code | NC1=NC(N2N=CC=C2)=NC(N3N=CC=C3)=C1Br |
| References | 1) Front. Pharmacol., 19 October 2018 https://doi.org/10.3389/fphar.2018.01200 |
Novel Antagonist of the Immune Checkpoint Protein Adenosine A2a Receptor, leading to the suppression of antitumor responses.