No products
View larger AT8185
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $156.40 | Total: $782.00 |
| 1 | 10 | $132.48 | Total: $1,324.80 |
| 1 | 25 | $112.24 | Total: $2,806.00 |
| 1 | 50 | $95.68 | Total: $4,784.00 |
| 1 | 100 | $82.80 | Total: $8,280.00 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.26 |
| CAS Numbers | 1857-30-3 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | O=C1O[C@]23[C@@]4(N([C@](C2)(C=CC3=C1)[H])CCCC4)[H] |
| References | Mensah JL, et al. Antibacterial activity of the leaves of Phyllanthus discoideus. J Ethnopharmacol. 1990 Feb;28[1] 129-33. |