No products
View larger AT17176
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $80.75 | Total: $403.75 |
| 1 | 10 | $68.40 | Total: $684.00 |
| 1 | 25 | $57.95 | Total: $1,448.75 |
| 1 | 50 | $49.40 | Total: $2,470.00 |
| 1 | 100 | $42.75 | Total: $4,275.00 |
| Molecular Formula | C17H18N6O8S |
| Molecular Weight | 466.43 |
| CAS Numbers | 863238-55-5 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | Nc1ncnc2n(cnc12)[C@@H]1O[C@H](COS(=O)(=O)NC(=O)c2ccccc2O)[C@@H](O)[C@H]1O |
| References | Citrome L. Cariprazine chemistry, pharmacodynamics, pharmacokinetics, and metabolism, clinical efficacy, safety, and tolerability. Expert Opin Drug Metab Toxicol. 2013;9[2] 193-206. |