View larger AT68109
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $117.30 | Total: $586.50 |
| 1 | 10 | $99.36 | Total: $993.60 |
| 1 | 25 | $84.18 | Total: $2,104.50 |
| 1 | 50 | $71.76 | Total: $3,588.00 |
| 1 | 100 | $62.10 | Total: $6,210.00 |
| Molecular Formula | C24H38N4O2 |
| Molecular Weight | 414.58 |
| CAS Numbers | 23790-08-1 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | N(CCCCCCN1CCN(CCC(C)O)CC1)C=2C3=C(C=C(OC)C2)C=CC=N3 |
| References | Beveridge E, et al. The activity against Trypanosoma cruzi and cutaneous leishmaniasis, and toxicity, of moxipraquine [349C59]. Trans R Soc Trop Med Hyg. 1980;74[1] 43-5 |