No products
View larger ATJS1748
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $95.20 | Total: $476.00 |
| 1 | 10 | $80.64 | Total: $806.40 |
| 1 | 25 | $68.32 | Total: $1,708.00 |
| 1 | 50 | $58.24 | Total: $2,912.00 |
| 1 | 100 | $50.40 | Total: $5,040.00 |
| Molecular Formula | C52H86O23 |
| Molecular Weight | 1079.23 |
| CAS Numbers | 54522-53-1 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | C[C@@]12[C@@]3([C@](C[C@]1([C@]4([C@](CC2)([C@]5(C)C(=CC4)C[C@@H](O[C@H]6[C@H](O[C@H]7[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O7)[C@@H](O[C@@H]8O[C@H](CO)[C@@H](O)[C@H](O)[C@H]8O)[C@H](O)[C@@H](CO)O6)CC5)[H])[H])[H])(O[C@@](CC[C@H](CO[C@@H]9O[C@H](CO)[C@@H](O)[C@H](O)[C@H]9O)C)(OC)[C@H]3C)[H])[H] |
| References | Hu K, Yao X. The cytotoxicity of methyl protoneogracillin [NSC-698793] and gracillin [NSC-698787], two steroidal saponins from the rhizomes of Dioscorea collettii var. hypoglauca, against human cancer cells in vitro. Phytother Res. 2003 Jun;17[6] 620-6. |