No products
View larger AT12264
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $286.45 | Total: $1,432.25 |
| 1 | 10 | $242.64 | Total: $2,426.40 |
| 1 | 25 | $205.57 | Total: $5,139.25 |
| 1 | 50 | $175.24 | Total: $8,762.00 |
| 1 | 100 | $151.65 | Total: $15,165.00 |
| Molecular Formula | C26H20Cl5FN2O2 |
| Molecular Weight | 588.71 |
| CAS Numbers | 53597-28-7 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | [Cl-].Fc1ccc(cc1)C(=O)C[n+]1ccn(CC(OCc2ccc(Cl)cc2Cl)c2ccc(Cl)cc2Cl)c1 |
| References | Andrew Redington. Methods relating to the use of remote ischemic conditioning. US 20160038737 A1. |