No products
View larger AT25982
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $392.70 | Total: $1,963.50 |
| 1 | 10 | $332.64 | Total: $3,326.40 |
| 1 | 25 | $281.82 | Total: $7,045.50 |
| 1 | 50 | $240.24 | Total: $12,012.00 |
| 1 | 100 | $207.90 | Total: $20,790.00 |
| Molecular Formula | C35H39F2N7O4 |
| Molecular Weight | 659.73 |
| CAS Numbers | 219923-85-0 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | C([C@]1(O[C@@H](COC2=CC=C(C=C2)N3CCN(CC3)C4=CC=C(C=C4)N5C(=O)N(C(C)C)CC5)OC1)C6=C(F)C=C(F)C=C6)N7C=NC=N7 |
| References | Geria AN, et al. Pramiconazole, a triazole compound for the treatment of fungal infections. IDrugs. 2008;11[9] 661-670. |