No products
View larger ATN2353
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $144.50 | Total: $722.50 |
| 1 | 10 | $122.40 | Total: $1,224.00 |
| 1 | 25 | $103.70 | Total: $2,592.50 |
| 1 | 50 | $88.40 | Total: $4,420.00 |
| 1 | 100 | $76.50 | Total: $7,650.00 |
| Molecular Formula | C15H10O6 |
| Molecular Weight | 286.24 |
| CAS Numbers | 41440-05-5 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | O=C1C=2C(OC(=C1)C3=CC=C(O)C=C3)=C(O)C(O)=CC2O |
| References | Markham K R, et al. The major flavonoids of an Antarctic Bryum. Phytochemistry. 1988;27[9] 2843-2845. |