No products
View larger AOB16971
CAS: 947018-15-7
Chemical Name: J9; 4-Cyclopropyl-5-pyridin-4-yl-pyrimidin-2-ylamine
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $31.45 | Total: $157.25 |
| 1 | 10 | $26.64 | Total: $266.40 |
| 1 | 25 | $22.57 | Total: $564.25 |
| 1 | 50 | $19.24 | Total: $962.00 |
| 1 | 100 | $16.65 | Total: $1,665.00 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.3 |
| CAS Numbers | 947018-15-7 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMF: 5 mg/ml DMF:PBS (pH 7.2)(1:3): 0.25 mg/ml DMSO: 10 mg/ml |
| Purity | 98% by HPLC |
| IUPAC/Chemical Name | 4-cyclopropyl-5-(4-pyridinyl)-2-pyrimidinamine |
| InChl Key | PQLYPFZAOUDDHB-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C12H12N4/c13-12-15-7-10(8-3-5-14-6-4-8)11(16-12)9-1-2-9/h3-7,9H,1-2H2,(H2,13,15,16) |
| SMILES Code | NC1=NC(C2CC2)=C(C3=CC=NC=C3)C=N1 |
| References | 1) Cantley, A.M., Welsch, M., Ambesi-Impiombato, A., et al. Small molecule that reverses dexamethasone resistance in T-cell acute lymphoblastic leukemia (T-ALL). ACS Med. Chem. Lett. 5(7), 754-759 (2014). |
Restorer of sensitivity to glucocorticoids through upregulation of the glucocorticoid receptor, reversing dexamethasone resistance in T-cell acute lymphoblastic Leukemia (T-ALL)