No products
View larger AOB8938
CAS 219694-63-0
Chemical Name: Vitaglutam; 5-((2-(1H-imidazol-4-yl)ethyl)amino)-5-oxopentanoic acid
10000 Items
| Quantity (mg or Unit) | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|
| 5 | $29.75 | Total: $148.75 |
| 10 | $25.20 | Total: $252.00 |
| 25 | $21.35 | Total: $533.75 |
| 50 | $18.20 | Total: $910.00 |
| 100 | $15.75 | Total: $1,575.00 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.11 |
| CAS Numbers | 219694-63-0 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | Ingavirin; Vitaglutam; Ingamine; Dicarbamin; |
| IUPAC/Chemical Name | 4-[2-(1H-Imidazol-4-yl)-ethylcarbamoyl]-butyric acid |
| InChl Key | KZIMLUFVKJLCCH-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C10H15N3O3/c14-9(2-1-3-10(15)16)12-5-4-8-6-11-7-13-8/h6-7H,1-5H2,(H,11,13)(H,12,14)(H,15,16) |
| SMILES Code | O=C(O)CCCC(NCCC1=CNC=N1)=O |
| References | 1) Kuznetsova OY, et al., Prevention of the recurrent herpetic stomatitis in employees of Kazan city industrial enterprises frequently suffering from acute respiratory viral infections]. Stomatologiia (Mosk). 2016;95(5):24-26. Russian. PubMed PMID: 27876718. 2: Shul'diakov AA, Let al.,Current principles in the chemoprophylaxis of acute respiratory viral infections]. Ter Arkh. 2013;85(11):27-33. Russian. PubMed PMID: 24432596. |
Novel inhibitor of the influenza virus reproduction, inhubiting the formation of the virus specific hemagglutinin