No products
View larger ATP1219
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $164.90 | Total: $824.50 |
| 1 | 10 | $139.68 | Total: $1,396.80 |
| 1 | 25 | $118.34 | Total: $2,958.50 |
| 1 | 50 | $100.88 | Total: $5,044.00 |
| 1 | 100 | $87.30 | Total: $8,730.00 |
| Molecular Formula | C129H207N45O41S3 |
| Molecular Weight | 3140.5 |
| CAS Numbers | 1366000-58-9 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | C(C)(O)=O.[C@H](CC1=CC=CC=C1)(C(N[C@H](C(N[C@@H](CC2=CC=C(O)C=C2)C(O)=O)=O)CCCNC(=N)N)=O)NC([C@@H](NC([C@@H](NC(=O)[C@@H]3CSSC[C@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@H](CO)N)=O)CC(C)C)=O)CCCNC(=N)N)=O)CCCNC(=N)N)=O)CO)=O)CO)=O)C(=O)N[C@@H](CC4=CC=CC=C4)C(=O)NCC(=O)NCC(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@]([C@H](CC)C)(C(=O)NCC(=O)N[C@@H](C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N3)[H])CC(N)=O)=O)CO)=O |
| References | Kohno M, et al. Atrial and brain natriuretic peptides inhibit the endothelin-1 secretory response to angiotensin II in porcine aorta. Circ Res. 1992 Feb;70[2] 241-7. |