No products
View larger AT7656
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $34.00 | Total: $170.00 |
| 1 | 10 | $28.80 | Total: $288.00 |
| 1 | 25 | $24.40 | Total: $610.00 |
| 1 | 50 | $20.80 | Total: $1,040.00 |
| 1 | 100 | $18.00 | Total: $1,800.00 |
| Molecular Formula | C69H111N23O16S |
| Molecular Weight | 1550.83 |
| CAS Numbers | 217082-58-1 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | C([C@@H](NC(=O)[C@H]1N(C(CNC([C@@H](NC([C@H](CC2=CN=CN2)NC([C@@H](NC([C@@H](NC([C@@H](NC(=O)[C@H]3N(C([C@@H](NC([C@H](CCC(N)=O)N)=O)CCCNC(=N)N)=O)CCC3)CCCNC(=N)N)=O)CC(C)C)=O)CO)=O)=O)CCCCN)=O)=O)CCC1)CCSC)(=O)N4[C@H](C(N[C@@H](CC5=CC=CC=C5)C(O)=O)=O)CCC4 |
| References | Tatemoto, K., Hosoya, M., Habata, Y., et al. Isolation and characterizaton of a novel endogenous peptide ligand for the human APJ receptor. Biochemical and Biophysical Research Communications 251, 471-476 [1998]. |