No products
View larger AOB1166B
CAS No: 1345858-76-5
Chemical Name: CYM50308; (2Z,5Z)-5-[[1-(2,4-Difluorophenyl)-2,5-dimethyl-1H-pyrrol-3-yl]methylene]-2-[(2-methoxyethyl)imino]-3-methyl-4-thiazolidinone; CID-49835928
5000 Items
| Quantity | 100 mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $573.75 | Total: $2,868.75 |
| 1 | 10 | $486.00 | Total: $4,860.00 |
| 1 | 25 | $411.75 | Total: $10,293.75 |
| 1 | 50 | $351.00 | Total: $17,550.00 |
| 1 | 100 | $303.75 | Total: $30,375.00 |
| Molecular Formula | C20H21F2N3O2S |
| Molecular Weight | 405.46 |
| CAS Numbers | 1345858-76-5 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | CID49835928; ML248; CYM-50308 |
| IUPAC/Chemical Name | (2Z,5Z)-5-[[1-(2,4-difluorophenyl)-2,5-dimethyl-1H-pyrrol-3-yl]methylene]-2-[(2-methoxyethyl)imino]-3-methyl-4-thiazolidinone |
| InChl Key | BKQZKTRCUAWRHT-ZGNGNRKCSA-N |
| InChl Code | InChI=1S/C20H21F2N3O2S/c1-12-9-14(13(2)25(12)17-6-5-15(21)11-16(17)22)10-18-19(26)24(3)20(28-18)23-7-8-27-4/h5-6,9-11H,7-8H2,1-4H3/b18-10-,23-20- |
| SMILES Code | FC1=CC(F)=C(N2C(C)=CC(/C=C3S/C(N(C)C3=O)=NCCOC)=C2C)C=C1 |
| References | 1) Urbano, M., et al. Discovery, synthesis and SAR analysis of novel selective small molecule S1P4-R agonists based on a (2Z,5Z)-5-((pyrrol-3-yl)methylene)-3-alkyl-2-(alkylimino)thiazolidin-4-one chemotype. Bioorg. Med. Chem. Lett. 21(22), 6739-6745 (2011). |
Novel Agonist of the Sphingosine 1-phosphate Receptor 4 (S1P4)