No products
View larger AT36442L
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $56.95 | Total: $284.75 |
| 1 | 10 | $48.24 | Total: $482.40 |
| 1 | 25 | $40.87 | Total: $1,021.75 |
| 1 | 50 | $34.84 | Total: $1,742.00 |
| 1 | 100 | $30.15 | Total: $3,015.00 |
| Molecular Formula | C52H77N15O14 |
| Molecular Weight | 1136.26 |
| CAS Numbers | 3 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | OC([C@H](CCCNC(N)=N)NC([C@@H](NC([C@@H]1CCCN1C([C@@H](NC([C@@H](NC(CNC([C@H]2C[C@@H](O)CN2C([C@@H]3CCCN3C([C@H](CCCNC(N)=N)N)=O)=O)=O)=O)CC4=CC=CC=C4)=O)CO)=O)=O)CC5=CC=CC=C5)=O)=O.CC(O)=O |
| References | R Dengler, et al. [Hyp3]-bradykinin and [Hyp3]-Lys-bradykinin interact with B2-bradykinin receptors and stimulate inositol phosphate production in cultured human fibroblasts. FEBS Lett. 1990 Mar 12;262[1] 111-4. |