No products
View larger AOB9559
CAS: 50370-56-4 (free base)
Chemical Name: WIN35428 Tartrate; ß-CFT; Methyl (1R,2S,3S,5S)-3-(4-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate Tartrate
Regulated product and listed it as purpose of scientific merit.
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $0.00 | Total: $0.00 |
| 1 | 10 | $0.00 | Total: $0.00 |
| 1 | 25 | $0.00 | Total: $0.00 |
| 1 | 50 | $0.00 | Total: $0.00 |
| 1 | 100 | $0.00 | Total: $0.00 |
| Molecular Formula | C20H26FNO8 |
| Molecular Weight | 427.43 |
| CAS Numbers | 50370-56-4 (free base) |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | WIN35428 Tartrate; ß-CFT |
| IUPAC/Chemical Name | Methyl (1R,2S,3S,5S)-3-(4-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate Tartrate |
| InChl Key | QUSLQENMLDRCTO-YJNKXOJESA-N |
| InChl Code | InChI=1S/C16H20FNO2/c1-18-12-7-8-14(18)15(16(19)20-2)13(9-12)10-3-5-11(17)6-4-10/h3-6,12-15H,7-9H2,1-2H3/t12-,13+,14+,15-/m0/s1 |
| SMILES Code | CN1[C@H]2CC[C@@H]1[C@H]([C@H](C2)C3=CC=C(C=C3)F)C(=O)OC |
Dopamine reuptake inhibitor, also having some SERT affinity