No products
View larger AT38754
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $211.65 | Total: $1,058.25 |
| 1 | 10 | $179.28 | Total: $1,792.80 |
| 1 | 25 | $151.89 | Total: $3,797.25 |
| 1 | 50 | $129.48 | Total: $6,474.00 |
| 1 | 100 | $112.05 | Total: $11,205.00 |
| Molecular Formula | C31H39N3O4 |
| Molecular Weight | 517.66 |
| CAS Numbers | 1352993-39-5 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | O=C(O)C1=CC=CC(=C1)CN2C(=O)C3(N(C2)C4CCCCC4)CCN(CCCC(=O)C=5C=CC=CC5)CC3 |
| References | Kuo B,et al. Randomised clinical trial safety, pharmacokinetics and pharmacodynamics of trazpiroben [TAK-906], a dopamine D2 D3 receptor antagonist, in patients with gastroparesis. Aliment Pharmacol Ther. 2021 Aug;54[3] 267-280. |