No products
View larger AT25886
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $1,178.10 | Total: $5,890.50 |
| 1 | 10 | $997.92 | Total: $9,979.20 |
| 1 | 25 | $845.46 | Total: $21,136.50 |
| 1 | 50 | $720.72 | Total: $36,036.00 |
| 1 | 100 | $623.70 | Total: $62,370.00 |
| Molecular Formula | C25H29N9O8 |
| Molecular Weight | 583.55 |
| CAS Numbers | 41600-13-9 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | NC=1C2=C(N=CC(CN(C)C3=CC=C(C(N[C@@H](CCC(N[C@@H](CCC(O)=O)C(O)=O)=O)C(O)=O)=O)C=C3)=N2)N=C(N)N1 |
| References | Chio LC, et al. Identification of highly potent and selective inhibitors of Toxoplasma gondii dihydrofolate reductase. Antimicrob Agents Chemother. 1993 Sep;37[9] 1914-23. |