No products
View larger AOB33326
CAS: 1219737-12-8
Chemical Name: 5-((5-([1,1"-Biphenyl]-4-yl)-6-chloro-1H-benzo[d]imidazol-2-yl)oxy)-2-methylbenzoic Acid
7000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $41.65 | Total: $208.25 |
| 1 | 10 | $35.28 | Total: $352.80 |
| 1 | 25 | $29.89 | Total: $747.25 |
| 1 | 50 | $25.48 | Total: $1,274.00 |
| 1 | 100 | $22.05 | Total: $2,205.00 |
| Molecular Formula | C26H31N3O |
| Molecular Weight | 401.55 |
| CAS Numbers | 280783-56-4 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | MK-3903; MK 3903; MK3903. |
| IUPAC/Chemical Name | 5-[(5-[1,1′-biphenyl]-4-yl-6-chloro-1H-benzimidazol-2-yl)oxy]-2-methyl-benzoic acid |
| InChl Key | FIKQZQDYGXAUHC-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C27H19ClN2O3/c1-16-7-12-20(13-21(16)26(31)32)33-27-29-24-14-22(23(28)15-25(24)30-27)19-10-8-18(9-11-19)17-5-3-2-4-6-17/h2-15H,1H3,(H,29,30)(H,31,32) |
| SMILES Code | ClC(C=C(N=C(OC1=CC=C(C)C(C(O)=O)=C1)N2)C2=C3)=C3C(C=C4)=CC=C4C5=CC=CC=C5 |
| References | 1) Lan, P., Romero, F.A., Wodka, D., et al. Hit-to-lead optimization and discovery of 5-((5-([1,1'-biphenyl]-4-yl)-6-chloro-1H-benzo[d]imidazol-2-yl)oxy)-2-methylbenzoic acid (MK-3903): A novel class of benzimidazole-based activators of AMP-activated protein kinase. J. Med. Chem. 60(21), 9040-9052 (2017). |
Novel potent and selective AMPK activator