

No products
View larger ATP1943L1
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $119.85 | Total: $599.25 |
| 1 | 10 | $101.52 | Total: $1,015.20 |
| 1 | 25 | $86.01 | Total: $2,150.25 |
| 1 | 50 | $73.32 | Total: $3,666.00 |
| 1 | 100 | $63.45 | Total: $6,345.00 |
| Molecular Formula | C64H99N13O21 |
| Molecular Weight | 1386.55 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | [H]N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(NCC(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(O)=O)[C@H](CC)C)=O)CCCCN)=O)C(C)C)=O)CCC(O)=O)=O)CCC(O)=O)=O)[C@H](CC)C)=O)=O)CC1=CC=C(C=C1)O)=O)C(C)C)=O)CC(N)=O)=O)CC2=CC=C(C=C2)O.CC(O)=O |
| References | Collingridge and Isaac [2003] Functional roles of protein interactions with AMPA and kainate receptors. Neurosci.Res. 47 3 PMID 12941441 |