No products
View larger AOB36548
CAS No: 900308-51-2
Chemical Name: N-(5-Chloro-2-methylphenyl)-4-(4-fluorophenyl)-2,4-dioxobutanamide
534 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $12.75 | Total: $63.75 |
| 1 | 10 | $10.80 | Total: $108.00 |
| 1 | 25 | $9.15 | Total: $228.75 |
| 1 | 50 | $7.80 | Total: $390.00 |
| 1 | 100 | $6.75 | Total: $675.00 |
| Molecular Formula | C17H13ClFNO3 |
| Molecular Weight | 333.74 |
| CAS Numbers | 900308-51-2 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | KL2; KL 2; KL-2 |
| IUPAC/Chemical Name | N-(5-Chloro-2-methylphenyl)-4-(4-fluorophenyl)-2,4-dioxobutanamide |
| InChl Key | LCMOHFZGRVNOPO-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C17H13ClFNO3/c1-10-2-5-12(18)8-14(10)20-17(23)16(22)9-15(21)11-3-6-13(19)7-4-11/h2-8H,9H2,1H3,(H,20,23) |
| SMILES Code | O=C(NC1=CC(Cl)=CC=C1C)C(CC(C2=CC=C(F)C=C2)=O)=O |
Novel inhibitor of SEC and transcription elongation by Pol II, disrupting the cyclin T1-AFF4 interaction within SEC, attenuating SEC-dependent rapid transcriptional responses, and inhibiting MYC transcriptional programs