No products
View larger AOB8475
CAS No: 2088001-24-3
Chemical Name: (S)-Benzyl (6-acrylamido-1-(4-(7-hydroxy-2-oxo-2H-chromene-3-carbonyl)piperazin-1-yl)-1-oxohexan-2-yl)carbamate
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $58.65 | Total: $293.25 |
| 1 | 10 | $49.68 | Total: $496.80 |
| 1 | 25 | $42.09 | Total: $1,052.25 |
| 1 | 50 | $35.88 | Total: $1,794.00 |
| 1 | 100 | $31.05 | Total: $3,105.00 |
| Molecular Formula | C31H34N4O8 |
| Molecular Weight | 590.62 |
| CAS Numbers | 2088001-24-3 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 95% by HPLC |
| Synonym | VA5; VA-5; VA 5; VA5 TG2 inhibitor |
| IUPAC/Chemical Name | (S)-Benzyl (6-acrylamido-1-(4-(7-hydroxy-2-oxo-2H-chromene-3-carbonyl)piperazin-1-yl)-1-oxohexan-2-yl)carbamate |
| InChl Key | MWRKONWQKZWDTC-VWLOTQADSA-N |
| InChl Code | InChI=1S/C31H34N4O8/c1-2-27(37)32-13-7-6-10-25(33-31(41)42-20-21-8-4-3-5-9-21)29(39)35-16-14-34(15-17-35)28(38)24-18-22-11-12-23(36)19-26(22)43-30(24)40/h2-5,8-9,11-12,18-19,25,36H,1,6-7,10,13-17,20H2,(H,32,37)(H,33,41)/t25-/m0/s1 |
| SMILES Code | O=C(OCC1=CC=CC=C1)N[C@@H](CCCCNC(C=C)=O)C(N2CCN(C(C(C3=O)=CC4=C(O3)C=C(O)C=C4)=O)CC2)=O |
| References | Kerr C, Szmacinski H, Fisher ML, Nance B, Lakowicz JR, Akbar A, Keillor JW, Lok Wong T, Godoy-Ruiz R, Toth EA, Weber DJ, Eckert RL. Transamidase site-targeted agents alter the conformation of the transglutaminase cancer stem cell survival protein to reduce GTP binding activity and cancer stem cell survival. Oncogene. 2017 May 25;36(21):2981-2990. |
Novel irreversible transglutaminase 2 (TG2) inhibitor