No products
View larger AOB17149
CAS: 2304947-71-3
Chemical Name: 4-(4-Bromo-2-oxo-2,3-dihydro-1H-benzo[d]imidazol-1-yl)-N-(4-iodophenyl)piperidine-1-carboxamide
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $12.75 | Total: $63.75 |
| 1 | 10 | $10.80 | Total: $108.00 |
| 1 | 25 | $9.15 | Total: $228.75 |
| 1 | 50 | $7.80 | Total: $390.00 |
| 1 | 100 | $6.75 | Total: $675.00 |
| Molecular Formula | C19H18BrIN4O2 |
| Molecular Weight | 541.18 |
| CAS Numbers | 2304947-71-3 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO 54.12 mg/mL, max Cons.100 mM |
| Purity | 98% by HPLC |
| Synonym | TH 5487; TH5487; TH-5487 |
| IUPAC/Chemical Name | 4-(4-Bromo-2,3-dihydro-2-oxo-1H-benzimidazol-1-yl)-N-(4-iodophenyl)-1-piperidinecarboxamide |
| InChl Key | FZLKVWWPFOLPKF-UHFFFAOYSA-N |
| SMILES Code | O=C(NC1=CC=C(I)C=C1)N(CC2)CCC2N(C3=CC=CC(Br)=C3N4)C4=O |
| References | Visnes et al (2018) Small-molecule inhibitor of OGG1 suppresses proinflammatory gene expression and inflammation. Science 362 834 PMID: 30442810 |
Novel selective active-site inhibitor of 8-oxoguanine DNA glycosylase 1 (OGG1)