No products
View larger AOB13925
CAS: 1040706-91-9
Chemical Name: (4-Methoxy-1H-indol-2-yl)(1,3,4,5-tetrahydro-2H-pyrido[4,3-b]indol-2-yl)methanone
923 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $12.75 | Total: $63.75 |
| 1 | 10 | $10.80 | Total: $108.00 |
| 1 | 25 | $9.15 | Total: $228.75 |
| 1 | 50 | $7.80 | Total: $390.00 |
| 1 | 100 | $6.75 | Total: $675.00 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.4 |
| CAS Numbers | 1040706-91-9 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | NPD10084; NPD-10084; NPD 10084 |
| IUPAC/Chemical Name | (4-Methoxy-1H-indol-2-yl)(1,3,4,5-tetrahydro-2H-pyrido[4,3-b]indol-2-yl)methanone |
| InChl Key | NKLSWHYOKYAGED-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C21H19N3O2/c1-26-20-8-4-7-17-14(20)11-19(23-17)21(25)24-10-9-18-15(12-24)13-5-2-3-6-16(13)22-18/h2-8,11,22-23H,9-10,12H2,1H3 |
| SMILES Code | COC1=CC=CC2=C1C=C(N2)C(=O)N3CCC4=C(C3)C5=CC=CC=C5N4 |
| References | 1) Ikuko N. et al. Identification of a Small Compound Targeting PKM2-Regulated Signaling Using 2D Gel Electrophoresis-Based Proteome-wide CETSA, Cell Chemical Biology, VOLUME 27, ISSUE 2, P186-196.E4, FEBRUARY 20, 2020 |
Novel inhibitor of PKM2-regulated signaling, suppressing non-glycolytic PKM2-regulated signaling in cancer cells