No products
View larger AOB1702
CAS: 1393556-48-3
Chemical Name: 5-[(1E)-2-(4-hydroxyphenyl)diazenyl]-1,3-Benzenediol
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $31.45 | Total: $157.25 |
| 1 | 10 | $26.64 | Total: $266.40 |
| 1 | 25 | $22.57 | Total: $564.25 |
| 1 | 50 | $19.24 | Total: $962.00 |
| 1 | 100 | $16.65 | Total: $1,665.00 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 |
| CAS Numbers | 1393556-48-3 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | Azo-Resveratrol |
| IUPAC/Chemical Name | 5-[(1E)-2-(4-hydroxyphenyl)diazenyl]-1,3-benzenediol |
| InChl Key | AVZQUPWHMPXTCT-BUHFOSPRSA-N |
| InChl Code | InChI=1S/C12H10N2O3/c15-10-3-1-8(2-4-10)13-14-9-5-11(16)7-12(17)6-9/h1-7,15-17H/b14-13+ |
| SMILES Code | C=CC(NC1=CC=C(C)C(OC2=CC=C(Cl)C=C2)=C1)=O |
| References | 1) Song YM, Ha YM, Kim JA, et al. Synthesis of novel azo-resveratrol, azo-oxyresveratrol and their derivatives as potent tyrosinase inhibitors. Bioorg Med Chem Lett. 2012;22(24):7451-7455. doi:10.1016/j.bmcl.2012.10.050 2) Bae SJ, Ha YM, Kim JA, et al. A novel synthesized tyrosinase inhibitor: (E)-2-((2,4-dihydroxyphenyl)diazenyl)phenyl 4-methylbenzenesulfonate as an azo-resveratrol analog. Biosci Biotechnol Biochem. 2013;77(1):65-72. doi:10.1271/bbb.120547 |
Potent tyrosinase inhibitor