No products
View larger AOB17113
CAS: 1799631-75-6
Chemical Name: S64315; (R)-2-((5-(3-Chloro-2-methyl-4-(2-(4-methylpiperazin-1-yl)ethoxy)phenyl)-6-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl)oxy)-3-(2-((2-(2-methoxyphenyl)pyrimidin-4-yl)methoxy)phenyl)propanoic acid
1975 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $41.65 | Total: $208.25 |
| 1 | 10 | $35.28 | Total: $352.80 |
| 1 | 25 | $29.89 | Total: $747.25 |
| 1 | 50 | $25.48 | Total: $1,274.00 |
| 1 | 100 | $22.05 | Total: $2,205.00 |
| Molecular Formula | C33H39N7O2 |
| Molecular Weight | 875.41 |
| CAS Numbers | 1799631-75-6 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | MIK665; MIK-665; MIK 665; S 64315; S-64315; S64315. |
| IUPAC/Chemical Name | (R)-2-((5-(3-chloro-2-methyl-4-(2-(4-methylpiperazin-1-yl)ethoxy)phenyl)-6-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl)oxy)-3-(2-((2-(2-methoxyphenyl)pyrimidin-4-yl)methoxy)phenyl)propanoic acid |
| InChl Key | PKYIMGFMRFVOMB-LDLOPFEMSA-N |
| InChl Code | InChI=1S/C47H44ClFN6O6S/c1-29-34(16-17-38(42(29)48)59-25-24-55-22-20-54(2)21-23-55)40-41-45(51-28-52-46(41)62-43(40)30-12-14-32(49)15-13-30)61-39(47(56)57)26-31-8-4-6-10-36(31)60-27-33-18-19-50-44(53-33)35-9-5-7-11-37(35)58-3/h4-19,28,39H,20-27H2,1-3H3,(H,56,57)/t39-/m1/s1 |
| SMILES Code | O=C(O)[C@@H](CC1=C(OCC2=NC(C3=C(OC)C=CC=C3)=NC=C2)C=CC=C1)OC4=C5C(SC(C6=CC=C(F)C=C6)=C5C7=C(C)C(Cl)=C(OCCN8CCN(C)CC8)C=C7)=NC=N4 |
| References | 1) Zoltán SZLÁVIK, et al. New hydroxyester derivatives, a process for their preparation and pharmaceutical compositions containing them. WO2016207225A1. |
Novel potent and selective Mcl-1 inhibitor