No products
View larger AOB37988
CAS: 944776-37-8
Chemical Name: RU166365; 3-[1-(1H-Benzimidazol-2-yl)-5-hydroxy-3-methyl-pyrazol-4-yl]-3H-isobenzofuran-1-one; ; 2-(1H-Benzimidazol-2-yl)-5-methyl-4-(3-oxo-1H-2-benzofuran-1-yl)-1H-pyrazol-3-one
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $58.65 | Total: $293.25 |
| 1 | 10 | $49.68 | Total: $496.80 |
| 1 | 25 | $42.09 | Total: $1,052.25 |
| 1 | 50 | $35.88 | Total: $1,794.00 |
| 1 | 100 | $31.05 | Total: $3,105.00 |
| Molecular Formula | C19H14N4O3 |
| Molecular Weight | 346.35 |
| CAS Numbers | 944776-37-8 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | RU166365 |
| IUPAC/Chemical Name | 3-[1-(1H-Benzimidazol-2-yl)-5-hydroxy-3-methyl-pyrazol-4-yl]-3H-isobenzofuran-1-one; ; 2-(1H-Benzimidazol-2-yl)-5-methyl-4-(3-oxo-1H-2-benzofuran-1-yl)-1H-pyrazol-3-one |
| InChl Key | OHRRAFUHDWTHIV-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C19H14N4O3/c1-10-15(16-11-6-2-3-7-12(11)18(25)26-16)17(24)23(22-10)19-20-13-8-4-5-9-14(13)21-19/h2-9,16,22H,1H3,(H,20,21) |
| SMILES Code | CC1=C(C(=O)N(N1)C2=NC3=CC=CC=C3N2)C4C5=CC=CC=C5C(=O)O4 |
| References | 1) Jessica Vincent et al., Small molecule inhibition of cGAS reduces interferon expression in primary macrophages from autoimmune mice, Nature Communications volume 8, Article number: 750 (2017) |
Novel selective inhibitor of cyclic GMP-AMP synthase (cGAS)