No products
View larger AOB15485
CAS: 501010-06-6
Chemical Name: GGTI2418; (2S)-2-[[(2S)-2-Benzyl-4-[(5-methyl-1H-imidazol-4-yl)methyl]-3-oxopiperazine-1-carbonyl]amino]-4-methylpentanoic acid
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $41.65 | Total: $208.25 |
| 1 | 10 | $35.28 | Total: $352.80 |
| 1 | 25 | $29.89 | Total: $747.25 |
| 1 | 50 | $25.48 | Total: $1,274.00 |
| 1 | 100 | $22.05 | Total: $2,205.00 |
| Molecular Formula | C23H31N5O4 |
| Molecular Weight | 441.5 |
| CAS Numbers | 501010-06-6 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | GGTI 2418; GGTI2418 |
| IUPAC/Chemical Name | N-[[(2S)-4-[(4-methyl-1H-imidazol-5-yl)methyl]-3-oxo-2-(phenylmethyl)-1-piperazinyl]carbonyl]-L-leucine |
| InChl Key | COLCNDRDBCLVOC-ICSRJNTNSA-N |
| InChl Code | InChI=1S/C23H31N5O4/c1-15(2)11-18(22(30)31)26-23(32)28-10-9-27(13-19-16(3)24-14-25-19)21(29)20(28)12-17-7-5-4-6-8-17/h4-8,14-15,18,20H,9-13H2,1-3H3,(H,24,25)(H,26,32)(H,30,31)/t18-,20-/m0/s1 |
| SMILES Code | O=C1[C@H](CC2=CC=CC=C2)N(C(N[C@H](C(O)=O)CC(C)C)=O)CCN1CC3=C(C)N=CN3 |
| References | 1) Kazi, A., Carie, A., Blaskovich, M.A., et al. Blockade of protein geranylgeranylation inhibits Cdk2-dependent p27Kip1 phosphorylation on Thr187 and accumulates p27Kip1 in the nucleus: Implications for breast cancer therapy. Mol. Cell Biol. 29(8), 2254-2263 (2009). |
Novel potent and selective geranylgeranyl transferase I (GGTase I) inhibitor, FBXL2, localization, sensitizer, xenotransplanted, tumours, photodynamic, therapy