No products
View larger AOB22823
CAS: 120964-45-6
Chemical Name: (1S,2R,5R)-5-(4-Amino-1H-imidazo[4,5-c]pyridin-1-yl)-3-(hydroxymethyl)-3-cyclopentene-1,2-diol hydrochloride
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $177.17 | Total: $885.87 |
| 1 | 10 | $150.08 | Total: $1,500.77 |
| 1 | 25 | $127.15 | Total: $3,178.71 |
| 1 | 50 | $108.39 | Total: $5,419.44 |
| 1 | 100 | $93.80 | Total: $9,379.80 |
| Molecular Formula | C12H14N4O3.HCl |
| Molecular Weight | 298.73 |
| CAS Numbers | 120964-45-6 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | DZNep,NSC 617989 |
| IUPAC/Chemical Name | (1S,2R,5R)-5-(4-Amino-1H-imidazo[4,5-c]pyridin-1-yl)-3-(hydroxymethyl)-3-cyclopentene-1,2-diol hydrochloride |
| InChl Key | UNSKMHKAFPRFTI-FDKLLANESA-N |
| SMILES Code | OCC([C@@H](O)[C@H]3O)=C[C@H]3N2C=NC1=C(N)N=CC=C12.Cl |
| References | 1) Tan et al (2007) Pharmacologic disruption of Polycomb-repressive complex 2-mediated gene repression selectively induces apoptosis in cancer cells. Genes Dev. 21 1050 PMID: 17437993 2) Miranda et al (2009) DZNep is a global histone methylation inhibitor that reactivates developmental genes not silenced by DNA methylation. Mol.Cancer Ther. 8 1579 PMID: 19509260 |
| PubChem ID | 14563109 |
3-Deazaneplanocin A hydrochloride is a histone methyltransferase inhibitor; decreases global histone methylation