No products
View larger ATP1628L
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $113.05 | Total: $565.25 |
| 1 | 10 | $95.76 | Total: $957.60 |
| 1 | 25 | $81.13 | Total: $2,028.25 |
| 1 | 50 | $69.16 | Total: $3,458.00 |
| 1 | 100 | $59.85 | Total: $5,985.00 |
| Molecular Formula | C93H134N22O25 |
| Molecular Weight | 1960.19 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | O=C(O)[C@H](CC1=CNC=N1)NC([C@H]([C@@H](C)CC)NC([C@H](CC2=CNC3=C2C=CC=C3)NC([C@H](CC(O)=O)NC([C@H](CC(C)C)NC([C@H](CC4=CC=C(O)C=C4)NC([C@H](CCCNC(N)=N)NC([C@H](CO)NC([C@H](C(C)C)NC([C@H](CCCCN)NC([C@H]([C@H](O)C)NC([C@H](CC5=CC=C(O)C=C5)NC([C@H](C(C)C)NC(CNC([C@H](CC6=CC=C(O)C=C6)N)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O.CC(O)=O |
| References | Mesters RM, et al. Identification of a sequence of human activated protein C [residues 390-404] essential for its anticoagulant activity. J Biol Chem. 1991 Dec 25;266[36] 24514-9. |