No products
View larger AT21607
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $31.45 | Total: $157.25 |
| 1 | 10 | $26.64 | Total: $266.40 |
| 1 | 25 | $22.57 | Total: $564.25 |
| 1 | 50 | $19.24 | Total: $962.00 |
| 1 | 100 | $16.65 | Total: $1,665.00 |
| Molecular Formula | C21H19Cl2N3O6S3 |
| Molecular Weight | 576.49 |
| CAS Numbers | 254877-67-3 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | N(S(=O)(=O)C1=CC=C(Cl)S1)C2=C(C(NC3=CC=C(S(=O)(=O)N4CCOCC4)C=C3)=O)C=C(Cl)C=C2 |
| References | Martinelli AM, et, al. In Endothelial Cells, the Activation or Stimulation of Soluble Guanylyl Cyclase Induces the Nitric Oxide Production by a Mechanism Dependent of Nitric Oxide Synthase Activation. J Pharm Pharm Sci. 2018;21[1] 38-45. |