No products
View larger AT30077
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $457.30 | Total: $2,286.50 |
| 1 | 10 | $387.36 | Total: $3,873.60 |
| 1 | 25 | $328.18 | Total: $8,204.50 |
| 1 | 50 | $279.76 | Total: $13,988.00 |
| 1 | 100 | $242.10 | Total: $24,210.00 |
| Molecular Formula | C18H39N7O3 |
| Molecular Weight | 401.55 |
| CAS Numbers | 170368-04-4 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | C(COC(NCCCCNCC[C@@H](C)N)=O)(NCCCCCCNC(=N)N)=O |
| References | Le Berre L,et al. Is there B cell involvement in a rat model of spontaneous idiopathic nephrotic syndrome treated with LF15-0195? J Nephrol. 2014 Jun;27[3] 265-73. |