



No products
View larger AOB8106
CAS: 194608-80-5
Chemical Name: 2-[3-Chloro-4-[3-[(3-phenyl-7-propyl-1-benzofuran-6-yl)oxy]propylsulfanyl]phenyl]acetic acid
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $67.15 | Total: $335.75 |
| 1 | 10 | $56.88 | Total: $568.80 |
| 1 | 25 | $48.19 | Total: $1,204.75 |
| 1 | 50 | $41.08 | Total: $2,054.00 |
| 1 | 100 | $35.55 | Total: $3,555.00 |
| Molecular Formula | C28H27ClO4S |
| Molecular Weight | 495.03 |
| CAS Numbers | 274901-16-5 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | L796449; L 796449 |
| IUPAC/Chemical Name | 2-[3-Chloro-4-[3-[(3-phenyl-7-propyl-1-benzofuran-6-yl)oxy]propylsulfanyl]phenyl]acetic acid |
| InChl Key | KAPDPGZDHUCILF-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C28H27ClO4S/c1-2-7-22-25(12-11-21-23(18-33-28(21)22)20-8-4-3-5-9-20)32-14-6-15-34-26-13-10-19(16-24(26)29)17-27(30)31/h3-5,8-13,16,18H,2,6-7,14-15,17H2,1H3,(H,30,31) |
| SMILES Code | O=C(O)CC1=CC=C(SCCCOC2=C(CCC)C3=C(C=C2)C(C4=CC=CC=C4)=CO3)C(Cl)=C1 |
| References | 1) Marta P. Pereira et al., The Nonthiazolidinedione PPARγ Agonist L-796,449 Is Neuroprotective in Experimental Stroke Journal of Neuropathology & Experimental Neurology, Volume 64, Issue 9, September 2005, Pages 797–805, https://doi.org/10.1097/01.jnen.0000178852.83680.3c |
Nonthiazolidinedione PPARgamma agonist, being neuroprotective in experimental stroke, displaying anti-inflammatory properties even though PPARgamma expression to be minimal or absent