No products
View larger AOB12228
CAS: 2697176-16-0
Chemical Name: 4-Fluoro-7-methyl-N-((1R,3S)-3-((S)-3-(N-methylmethylsulfonamido)pyrrolidin-1-yl)cyclohexyl)-1H-indole-2-carboxamide
991 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $101.15 | Total: $505.75 |
| 1 | 10 | $85.68 | Total: $856.80 |
| 1 | 25 | $72.59 | Total: $1,814.75 |
| 1 | 50 | $61.88 | Total: $3,094.00 |
| 1 | 100 | $53.55 | Total: $5,355.00 |
| Molecular Formula | C22H31FN4O3S |
| Molecular Weight | 450.57 |
| CAS Numbers | 2697176-16-0 (free base) |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | EPZ-719; EPZ719; EPZ 719; |
| IUPAC/Chemical Name | 4-fluoro-7-methyl-N-((1R,3S)-3-((S)-3-(N-methylmethylsulfonamido)pyrrolidin-1-yl)cyclohexyl)-1H-indole-2-carboxamide |
| InChl Key | ZLVKIBLQXFILMA-IKGGRYGDSA-N |
| InChl Code | InChI=1S/C22H31FN4O3S/c1-14-7-8-19(23)18-12-20(25-21(14)18)22(28)24-15-5-4-6-16(11-15)27-10-9-17(13-27)26(2)31(3,29)30/h7-8,12,15-17,25H,4-6,9-11,13H2,1-3H3,(H,24,28)/t15-,16+,17+/m1/s1 |
| SMILES Code | O=C(C(N1)=CC2=C1C(C)=CC=C2F)N[C@H]3C[C@@H](N4C[C@@H](N(C)S(=O)(C)=O)CC4)CCC3 |
| References | 1) Lampe JW, Alford JS, Boriak-Sjodin PA, Brach D, Cosmopoulos K, Duncan KW, Eckley ST, Foley MA, Harvey DM, Motwani V, Munchhof MJ, Raimondi A, Riera TV, Tang C, Thomenius MJ, Totman J, Farrow NA. Discovery of a First-in-Class Inhibitor of the Histone Methyltransferase SETD2 Suitable for Preclinical Studies. ACS Med Chem Lett. 2021 Aug 24;12(10):1539-1545. doi: 10.1021/acsmedchemlett.1c00272. PMID: 34671445; PMCID: PMC8521618. |
First-in-Class Inhibitor of the Histone Methyltransferase SETD2 with a high selectivity over other histone methyltransferases