No products
View larger AT17211
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $129.20 | Total: $646.00 |
| 1 | 10 | $109.44 | Total: $1,094.40 |
| 1 | 25 | $92.72 | Total: $2,318.00 |
| 1 | 50 | $79.04 | Total: $3,952.00 |
| 1 | 100 | $68.40 | Total: $6,840.00 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.39 |
| CAS Numbers | 1357362-02-7 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | Nc1nnc(CN[C@@H]2C[C@H]2c2ccc(OCc3ccccc3)cc2)o1 |
| References | Antonijoan RM,et al. First-in-Human Randomized Trial to Assess Safety, Tolerability, Pharmacokinetics and Pharmacodynamics of the KDM1A Inhibitor Vafidemstat. CNS Drugs. 2021 Mar;35[3] 331-344. |