View larger AT40254
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $287.30 | Total: $1,436.50 |
| 1 | 10 | $243.36 | Total: $2,433.60 |
| 1 | 25 | $206.18 | Total: $5,154.50 |
| 1 | 50 | $175.76 | Total: $8,788.00 |
| 1 | 100 | $152.10 | Total: $15,210.00 |
| Molecular Formula | C23H18ClFN6O2 |
| Molecular Weight | 464.88 |
| CAS Numbers | 2630904-45-7 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | CN1C(=C(C=N1)C=2C=C3C(=CC2)C(=O)NN=C3CN)C4=C(C#N)C(OC5CC5)=CC(Cl)=C4F |
| References | Targeting the genetic and immunological drivers of cancer. |