No products
View larger AOB36436
CAS No: 1263893-98-6 (Free Base)
Chemical Name: 2-((2-Amino-9-(2-(diethylamino)ethyl)-9H-purin-6-yl)thio)acetic acid Hydrochloride
5000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $38.25 | Total: $191.25 |
| 1 | 10 | $32.40 | Total: $324.00 |
| 1 | 25 | $27.45 | Total: $686.25 |
| 1 | 50 | $23.40 | Total: $1,170.00 |
| 1 | 100 | $20.25 | Total: $2,025.00 |
| Molecular Formula | C13H20N6O2S HCl |
| Molecular Weight | 360.86 |
| CAS Numbers | 1263893-98-6 (Free Base) |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | zr172 HCl; zr17-2 HCl; zr17 2 HCl; zr172 Hydrochloride; zr17-2 Hydrochloride; zr17 2 Hydrochloride |
| IUPAC/Chemical Name | 2-((2-Amino-9-(2-(diethylamino)ethyl)-9H-purin-6-yl)thio)acetic acid hydrochloride |
| InChl Key | MZLWOCJFMQAKBF-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C13H20N6O2S.ClH/c1-3-18(4-2)5-6-19-8-15-10-11(19)16-13(14)17-12(10)22-7-9(20)21;/h8H,3-7H2,1-2H3,(H,20,21)(H2,14,16,17);1H |
| SMILES Code | O=C(O)CSC1=C2N=CN(CCN(CC)CC)C2=NC(N)=N1.[H]Cl |
The first small molecule modulator of cold inducible RNA-binding protein (CIRBP) activity