No products
View larger AOB13986
CAS: 2225938-17-8
Chemical Name: 6-(6-(4-(2-(2-(Adamantan-1-yl)acetamido)ethyl)piperazin-1-yl)pyridin-3-yl)-N-((4,6-dimethyl-2-oxo-1,2-dihydropyridin-3-yl)methyl)-1-isopropyl-1H-indazole-4-carboxamide
4988 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $58.65 | Total: $293.25 |
| 1 | 10 | $49.68 | Total: $496.80 |
| 1 | 25 | $42.09 | Total: $1,052.25 |
| 1 | 50 | $35.88 | Total: $1,794.00 |
| 1 | 100 | $31.05 | Total: $3,105.00 |
| Molecular Formula | C₄₂H₅₄N₈O₃ |
| Molecular Weight | 718.93 |
| CAS Numbers | 2225938-17-8 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| IUPAC/Chemical Name | 6-(6-(4-(2-(2-(Adamantan-1-yl)acetamido)ethyl)piperazin-1-yl)pyridin-3-yl)-N-((4,6-dimethyl-2-oxo-1,2-dihydropyridin-3-yl)methyl)-1-isopropyl-1H-indazole-4-carboxamide |
| SMILES Code | CC(C)N(N=C1)C2=C1C(C(NCC3=C(C)C=C(C)NC3=O)=O)=CC(C4=CC=C(N=C4)N(CC5)CCN5CCNC(CC67C[C@H]8C[C@H](C[C@H](C8)C7)C6)=O)=C2 |
| References | 1) Ma A, et al. Discovery of a first-in-class EZH2 selective degrader.Nat Chem Biol. 2020 Feb;16(2):214-222. |
First-in-class EZH2 selective degrader that effectively reduces EZH2 levels in cells