No products
View larger AOB2407829654
CAS: 2407829-65-4
Chemical Name: 2-(2,6-dioxopiperidin-3-yl)-5-hydroxy-1H-benzo[de]isoquinoline-1,3(2H)-dione
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $126.65 | Total: $633.25 |
| 1 | 10 | $107.28 | Total: $1,072.80 |
| 1 | 25 | $90.89 | Total: $2,272.25 |
| 1 | 50 | $77.48 | Total: $3,874.00 |
| 1 | 100 | $67.05 | Total: $6,705.00 |
| Molecular Formula | C17H12N2O5 |
| Molecular Weight | 324.29 |
| CAS Numbers | 2407829-65-4 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | WUN29654; WUN-29654; WUN 29654; |
| IUPAC/Chemical Name | 2-(2,6-dioxopiperidin-3-yl)-5-hydroxy-1H-benzo[de]isoquinoline-1,3(2H)-dione |
| InChl Key | WGTKYDFLBDSIPX-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C17H12N2O5/c20-9-6-8-2-1-3-10-14(8)11(7-9)17(24)19(16(10)23)12-4-5-13(21)18-15(12)22/h1-3,6-7,12,20H,4-5H2,(H,18,21,22) |
| SMILES Code | O=C(C1=C2C(C=C(O)C=C23)=CC=C1)N(C4CCC(NC4=O)=O)C3=O |
| References | 1) Gray, Nathanael; et al., 2-(2,6-Dioxopiperidin-3-yl)benzo[de]isoquinoline-1,3(2H)-diones as CRBN modulators and their preparation. PCT Int. Appl. (2020), WO 2020006262. |
CRBN modulator, which showed CRBN modulatory activity with IC50 value of 2.6μM, Ki value of 0.7μM and cell proliferation IC50 vale of ~21.53μM. WUN29654 was reported in patent WO 2020006262 (compound II).