No products
View larger AOB5392
CAS: 1565827-99-7
Chemical Name: 2-((1S,3S,4aS,9aR)-6-(Dimethylamino)-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b]benzofuran-3-yl)-N-(4-phenoxybenzyl)acetamide
910 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $67.15 | Total: $335.75 |
| 1 | 10 | $56.88 | Total: $568.80 |
| 1 | 25 | $48.19 | Total: $1,204.75 |
| 1 | 50 | $41.08 | Total: $2,054.00 |
| 1 | 100 | $35.55 | Total: $3,555.00 |
| Molecular Formula | C29H32N2O5 |
| Molecular Weight | 488.58 |
| CAS Numbers | 1565827-99-7 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | BRD0418; BRD-0418; BRD 0418; |
| IUPAC/Chemical Name | 2-((1S,3S,4aS,9aR)-6-(Dimethylamino)-1-(hydroxymethyl)-3,4,4a,9a-tetrahydro-1H-pyrano[3,4-b]benzofuran-3-yl)-N-(4-phenoxybenzyl)acetamide |
| InChl Key | MRJCPWMBHXTRFB-HGAMEBRSSA-N |
| InChl Code | InChI=1S/C29H32N2O5/c1-31(2)20-10-13-26-24(14-20)25-15-23(35-27(18-32)29(25)36-26)16-28(33)30-17-19-8-11-22(12-9-19)34-21-6-4-3-5-7-21/h3-14,23,25,27,29,32H,15-18H2,1-2H3,(H,30,33)/t23-,25-,27-,29+/m0/s1 |
| SMILES Code | O=C(NCC1=CC=C(OC2=CC=CC=C2)C=C1)C[C@@H]3C[C@]4([H])[C@@]([C@H](CO)O3)([H])OC5=CC=C(N(C)C)C=C45 |
Novel upregulator of TRIB1 expression, leading to reprogramming of hepatic lipoprotein metabolism from lipogenesis to scavenging